C27H19ClFN5O — CID 68713095
4-(2-chloro-6-fluorophenyl)-15-[6-(dimethylamino)-3-pyridinyl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 68713095) has the molecular formula C27H19ClFN5O and a molecular weight of 483.93 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-15-[6-(dimethylamino)-3-pyridinyl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-15-[6-(dimethylamino)-3-pyridinyl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 68713095 |
| Molecular Formula | C27H19ClFN5O |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-15-[6-(dimethylamino)-3-pyridinyl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | CN(C)c1ccc(-c2ccc3c(c2)c2c(=O)[nH]ccc2c2nc(-c4c(F)cccc4Cl)[nH]c32)cn1 |
| InChI | InChI=1S/C27H19ClFN5O/c1-34(2)21-9-7-15(13-31-21)14-6-8-16-18(12-14)22-17(10-11-30-27(22)35)25-24(16)32-26(33-25)23-19(28)4-3-5-20(23)29/h3-13H,1-2H3,(H,30,35)(H,32,33) |
| InChIKey | CLFYCKOVQNANDY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|