C22H30N2O4S — CID 68713185
(2S,3S)-3-methyl-2-[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide (PubChem CID 68713185) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide.
| Compound Name | (2S,3S)-3-methyl-2-[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
|---|---|
| PubChem CID | 68713185 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2S,3S)-3-methyl-2-[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
| SMILES | C[C@H]1[C@H](C2C=CC(OCCCN3CCCCC3)=CC2)Oc2cccnc2S1(=O)=O |
| InChI | InChI=1S/C22H30N2O4S/c1-17-21(28-20-7-5-12-23-22(20)29(17,25)26)18-8-10-19(11-9-18)27-16-6-15-24-13-3-2-4-14-24/h5,7-8,10-12,17-18,21H,2-4,6,9,13-16H2,1H3/t17-,18?,21+/m0/s1 |
| InChIKey | QDDAUKHHAYPSKJ-KXXXGBTESA-N |
| XLogP | 3.36 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|