About 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine
4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 68713759) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 68713759 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NC(CSc2ccccc2)CO1 |
| InChI | InChI=1S/C10H12N2OS/c11-10-12-8(6-13-10)7-14-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,11,12) |
| InChIKey | OXEGIMJKTHLUEG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine (CID 68713759) is 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine is NC1=NC(CSc2ccccc2)CO1.
What is the InChIKey of 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is OXEGIMJKTHLUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c11-10-12-8(6-13-10)7-14-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,11,12).
What are the key properties of 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine?
4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 208.29 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(phenylsulfanylmethyl)-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 68713759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).