C9H4F3NO2S — CID 68713920
5-(trifluoromethyl)-1,3-benzothiazole-2-carboxylic acid (PubChem CID 68713920) has the molecular formula C9H4F3NO2S and a molecular weight of 247.20 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,3-benzothiazole-2-carboxylic acid.
| Compound Name | 5-(trifluoromethyl)-1,3-benzothiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 68713920 |
| Molecular Formula | C9H4F3NO2S |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 5-(trifluoromethyl)-1,3-benzothiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C9H4F3NO2S/c10-9(11,12)4-1-2-6-5(3-4)13-7(16-6)8(14)15/h1-3H,(H,14,15) |
| InChIKey | ONMLBVIBBVDKTA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |