C19H26N6O — CID 68714052
1-imidazo[1,2-a]pyrazin-3-yl-2,2,5-trimethyl-1-(pyrimidin-2-ylamino)hexan-1-ol (PubChem CID 68714052) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyrazin-3-yl-2,2,5-trimethyl-1-(pyrimidin-2-ylamino)hexan-1-ol.
| Compound Name | 1-imidazo[1,2-a]pyrazin-3-yl-2,2,5-trimethyl-1-(pyrimidin-2-ylamino)hexan-1-ol |
|---|---|
| PubChem CID | 68714052 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-imidazo[1,2-a]pyrazin-3-yl-2,2,5-trimethyl-1-(pyrimidin-2-ylamino)hexan-1-ol |
| SMILES | CC(C)CCC(C)(C)C(O)(Nc1ncccn1)c1cnc2cnccn12 |
| InChI | InChI=1S/C19H26N6O/c1-14(2)6-7-18(3,4)19(26,24-17-21-8-5-9-22-17)15-12-23-16-13-20-10-11-25(15)16/h5,8-14,26H,6-7H2,1-4H3,(H,21,22,24) |
| InChIKey | BLHRCXFDVCQHJM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|