C18H24N6O — CID 68714189
1-imidazo[1,2-a]pyrazin-3-yl-2,2,4-trimethyl-1-(pyrimidin-2-ylamino)pentan-1-ol (PubChem CID 68714189) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyrazin-3-yl-2,2,4-trimethyl-1-(pyrimidin-2-ylamino)pentan-1-ol.
| Compound Name | 1-imidazo[1,2-a]pyrazin-3-yl-2,2,4-trimethyl-1-(pyrimidin-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 68714189 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-imidazo[1,2-a]pyrazin-3-yl-2,2,4-trimethyl-1-(pyrimidin-2-ylamino)pentan-1-ol |
| SMILES | CC(C)CC(C)(C)C(O)(Nc1ncccn1)c1cnc2cnccn12 |
| InChI | InChI=1S/C18H24N6O/c1-13(2)10-17(3,4)18(25,23-16-20-6-5-7-21-16)14-11-22-15-12-19-8-9-24(14)15/h5-9,11-13,25H,10H2,1-4H3,(H,20,21,23) |
| InChIKey | FTKZUPXRAUTCLS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|