C34H31N3O8S — CID 68714541
methyl 3-methyl-2-[[4-[4-[[3-methyl-4-(3-nitrophenyl)-1-benzofuran-2-carbonyl]amino]phenyl]phenyl]sulfonylamino]butanoate (PubChem CID 68714541) has the molecular formula C34H31N3O8S and a molecular weight of 641.70 g/mol. Its IUPAC name is methyl 3-methyl-2-[[4-[4-[[3-methyl-4-(3-nitrophenyl)-1-benzofuran-2-carbonyl]amino]phenyl]phenyl]sulfonylamino]butanoate.
| Compound Name | methyl 3-methyl-2-[[4-[4-[[3-methyl-4-(3-nitrophenyl)-1-benzofuran-2-carbonyl]amino]phenyl]phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 68714541 |
| Molecular Formula | C34H31N3O8S |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | methyl 3-methyl-2-[[4-[4-[[3-methyl-4-(3-nitrophenyl)-1-benzofuran-2-carbonyl]amino]phenyl]phenyl]sulfonylamino]butanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(-c2ccc(NC(=O)c3oc4cccc(-c5cccc([N+](=O)[O-])c5)c4c3C)cc2)cc1)C(C)C |
| InChI | InChI=1S/C34H31N3O8S/c1-20(2)31(34(39)44-4)36-46(42,43)27-17-13-23(14-18-27)22-11-15-25(16-12-22)35-33(38)32-21(3)30-28(9-6-10-29(30)45-32)24-7-5-8-26(19-24)37(40)41/h5-20,31,36H,1-4H3,(H,35,38) |
| InChIKey | DSVPGGFVRITYMB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|