C23H20N4O2 — CID 68714595
[4-[(1-oxo-2,3,4,7-tetrahydroindolo[2,3-c]quinolin-6-yl)methyl]phenyl]urea (PubChem CID 68714595) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is [4-[(1-oxo-2,3,4,7-tetrahydroindolo[2,3-c]quinolin-6-yl)methyl]phenyl]urea.
| Compound Name | [4-[(1-oxo-2,3,4,7-tetrahydroindolo[2,3-c]quinolin-6-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 68714595 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [4-[(1-oxo-2,3,4,7-tetrahydroindolo[2,3-c]quinolin-6-yl)methyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(Cc2nc3c(c4c2[nH]c2ccccc24)C(=O)CCC3)cc1 |
| InChI | InChI=1S/C23H20N4O2/c24-23(29)25-14-10-8-13(9-11-14)12-18-22-20(15-4-1-2-5-16(15)27-22)21-17(26-18)6-3-7-19(21)28/h1-2,4-5,8-11,27H,3,6-7,12H2,(H3,24,25,29) |
| InChIKey | FJMVDRVTQZQWDU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |