C22H20Cl2N8O2 — CID 68714912
4-[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]-3-nitropyridine-2,6-diamine (PubChem CID 68714912) has the molecular formula C22H20Cl2N8O2 and a molecular weight of 499.36 g/mol. Its IUPAC name is 4-[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]-3-nitropyridine-2,6-diamine.
| Compound Name | 4-[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 68714912 |
| Molecular Formula | C22H20Cl2N8O2 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1cc(C2CCCN(c3nc(-c4ccc(Cl)cc4Cl)cc4nccn34)C2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C22H20Cl2N8O2/c23-13-3-4-14(16(24)8-13)17-10-19-27-5-7-31(19)22(28-17)30-6-1-2-12(11-30)15-9-18(25)29-21(26)20(15)32(33)34/h3-5,7-10,12H,1-2,6,11H2,(H4,25,26,29) |
| InChIKey | WBGRWUQGQAPNKP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|