C27H39FO6Si — CID 68715539
[2-[(10S,11S,13S,16S,17R)-9-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-trimethylsilyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 68715539) has the molecular formula C27H39FO6Si and a molecular weight of 506.69 g/mol. Its IUPAC name is [2-[(10S,11S,13S,16S,17R)-9-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-trimethylsilyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(10S,11S,13S,16S,17R)-9-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-trimethylsilyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 68715539 |
| Molecular Formula | C27H39FO6Si |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [2-[(10S,11S,13S,16S,17R)-9-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-11-trimethylsilyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)[C@@H](C)CC2C3CCC4=CC(=O)C=C[C@]4(C)C3(F)[C@@H](O[Si](C)(C)C)C[C@@]21C |
| InChI | InChI=1S/C27H39FO6Si/c1-16-12-21-20-9-8-18-13-19(30)10-11-24(18,3)26(20,28)23(34-35(5,6)7)14-25(21,4)27(16,32)22(31)15-33-17(2)29/h10-11,13,16,20-21,23,32H,8-9,12,14-15H2,1-7H3/t16-,20?,21?,23-,24-,25-,26?,27-/m0/s1 |
| InChIKey | AKORXZJFSXRDHM-FLCSIMQTSA-N |
| XLogP | 4.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|