About N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide
N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide (PubChem CID 6871654) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide |
| PubChem CID | 6871654 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide |
| SMILES | C=CCOc1cccc(/C=N/NC(=O)C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-3-11-26-15-8-6-7-14(12-15)13-20-22-19(24)18(23)21-16-9-4-5-10-17(16)25-2/h3-10,12-13H,1,11H2,2H3,(H,21,23)(H,22,24)/b20-13+ |
| InChIKey | IXKNJIAGQHKKEC-DEDYPNTBSA-N |
| XLogP | 2.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide?
The IUPAC name of N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide (CID 6871654) is N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide.
What is the SMILES notation for N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide?
The canonical SMILES for N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide is C=CCOc1cccc(/C=N/NC(=O)C(=O)Nc2ccccc2OC)c1.
What is the InChIKey of N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide?
The InChIKey is IXKNJIAGQHKKEC-DEDYPNTBSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-3-11-26-15-8-6-7-14(12-15)13-20-22-19(24)18(23)21-16-9-4-5-10-17(16)25-2/h3-10,12-13H,1,11H2,2H3,(H,21,23)(H,22,24)/b20-13+.
What are the key properties of N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide?
N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide has a molecular weight of 353.38 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-N'-[(E)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide is sourced from PubChem (CID 6871654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).