C21H20F4N2O4 — CID 68716789
1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-1-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid (PubChem CID 68716789) has the molecular formula C21H20F4N2O4 and a molecular weight of 440.39 g/mol. Its IUPAC name is 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-1-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-1-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68716789 |
| Molecular Formula | C21H20F4N2O4 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-1-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C=CN1CCCCC1)c1ccc(Oc2ccc(F)cc2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H19FN2O2.C2HF3O2/c20-16-5-7-17(8-6-16)24-19-9-4-15(14-21-19)18(23)10-13-22-11-2-1-3-12-22;3-2(4,5)1(6)7/h4-10,13-14H,1-3,11-12H2;(H,6,7) |
| InChIKey | SNLWBSPZRTZMKE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|