C21H23N3O4S — CID 68716797
4-[[1-(benzenesulfonyl)-2-methylindol-4-yl]methyl]piperazine-1-carboxylic acid (PubChem CID 68716797) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-[[1-(benzenesulfonyl)-2-methylindol-4-yl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[1-(benzenesulfonyl)-2-methylindol-4-yl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68716797 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-[[1-(benzenesulfonyl)-2-methylindol-4-yl]methyl]piperazine-1-carboxylic acid |
| SMILES | Cc1cc2c(CN3CCN(C(=O)O)CC3)cccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-16-14-19-17(15-22-10-12-23(13-11-22)21(25)26)6-5-9-20(19)24(16)29(27,28)18-7-3-2-4-8-18/h2-9,14H,10-13,15H2,1H3,(H,25,26) |
| InChIKey | SPRDMBSTZPQQGT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |