C43H38Cl2N4O5 — CID 68716837
methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2,3,6,7,8,9-hexahydropyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoate (PubChem CID 68716837) has the molecular formula C43H38Cl2N4O5 and a molecular weight of 761.71 g/mol. Its IUPAC name is methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2,3,6,7,8,9-hexahydropyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2,3,6,7,8,9-hexahydropyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 68716837 |
| Molecular Formula | C43H38Cl2N4O5 |
| Molecular Weight | 761.71 g/mol |
| Exact Mass | 760.22 |
| IUPAC Name | methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2,3,6,7,8,9-hexahydropyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccc(C#N)cc2)cc1)NC(=O)C1Cc2cc3c(cc2CN1)OC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CN3C |
| InChI | InChI=1S/C43H38Cl2N4O5/c1-49-24-41(31-12-14-34(15-13-31)53-25-28-7-16-35(44)36(45)17-28)54-40-21-33-23-47-37(19-32(33)20-39(40)49)42(50)48-38(43(51)52-2)18-26-3-8-29(9-4-26)30-10-5-27(22-46)6-11-30/h3-17,20-21,37-38,41,47H,18-19,23-25H2,1-2H3,(H,48,50)/t37?,38-,41?/m0/s1 |
| InChIKey | SBRJJILRBNATLO-VGTZNZOGSA-N |
| XLogP | 7.60 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|