About 6-ethenyltriazine-4,5-diamine
6-ethenyltriazine-4,5-diamine (PubChem CID 68717426) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 6-ethenyltriazine-4,5-diamine.
Molecular Properties
| Compound Name | 6-ethenyltriazine-4,5-diamine |
| PubChem CID | 68717426 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 6-ethenyltriazine-4,5-diamine |
| SMILES | C=Cc1nnnc(N)c1N |
| InChI | InChI=1S/C5H7N5/c1-2-3-4(6)5(7)9-10-8-3/h2H,1H2,(H2,6,10)(H2,7,8,9) |
| InChIKey | BUHJIRZBYDNMNB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethenyltriazine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyltriazine-4,5-diamine?
The IUPAC name of 6-ethenyltriazine-4,5-diamine (CID 68717426) is 6-ethenyltriazine-4,5-diamine.
What is the SMILES notation for 6-ethenyltriazine-4,5-diamine?
The canonical SMILES for 6-ethenyltriazine-4,5-diamine is C=Cc1nnnc(N)c1N.
What is the InChIKey of 6-ethenyltriazine-4,5-diamine?
The InChIKey is BUHJIRZBYDNMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c1-2-3-4(6)5(7)9-10-8-3/h2H,1H2,(H2,6,10)(H2,7,8,9).
What are the key properties of 6-ethenyltriazine-4,5-diamine?
6-ethenyltriazine-4,5-diamine has a molecular weight of 137.15 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyltriazine-4,5-diamine is sourced from PubChem (CID 68717426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).