C29H28F2N4O8S2 — CID 68717517
3-(benzenesulfonamidomethylideneamino)-N-[4-(1,3-benzoxazol-2-yl)-4-oxobutyl]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]propanamide (PubChem CID 68717517) has the molecular formula C29H28F2N4O8S2 and a molecular weight of 662.69 g/mol. Its IUPAC name is 3-(benzenesulfonamidomethylideneamino)-N-[4-(1,3-benzoxazol-2-yl)-4-oxobutyl]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]propanamide.
| Compound Name | 3-(benzenesulfonamidomethylideneamino)-N-[4-(1,3-benzoxazol-2-yl)-4-oxobutyl]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 68717517 |
| Molecular Formula | C29H28F2N4O8S2 |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | 3-(benzenesulfonamidomethylideneamino)-N-[4-(1,3-benzoxazol-2-yl)-4-oxobutyl]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]propanamide |
| SMILES | O=C(CC(N=CNS(=O)(=O)c1ccccc1)S(=O)(=O)Cc1ccccc1OC(F)F)NCCCC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C29H28F2N4O8S2/c30-29(31)43-24-14-6-4-9-20(24)18-44(38,39)27(33-19-34-45(40,41)21-10-2-1-3-11-21)17-26(37)32-16-8-13-23(36)28-35-22-12-5-7-15-25(22)42-28/h1-7,9-12,14-15,19,27,29H,8,13,16-18H2,(H,32,37)(H,33,34) |
| InChIKey | XKHYRGSGVYLJRR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 174.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|