C11H16F3N5 — CID 68717549
5-piperidin-4-yl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-diamine (PubChem CID 68717549) has the molecular formula C11H16F3N5 and a molecular weight of 275.28 g/mol. Its IUPAC name is 5-piperidin-4-yl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-piperidin-4-yl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68717549 |
| Molecular Formula | C11H16F3N5 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-piperidin-4-yl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c(C2CCNCC2)c(C(F)C(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5/c12-7(9(13)14)8-6(5-1-3-17-4-2-5)10(15)19-11(16)18-8/h5,7,9,17H,1-4H2,(H4,15,16,18,19) |
| InChIKey | MUGYYRUCKJYBSA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |