C11H10F5N5O2 — CID 68718144
1,1,1,3,3-pentafluoro-4-[5-methyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxybutan-2-ol (PubChem CID 68718144) has the molecular formula C11H10F5N5O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-4-[5-methyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxybutan-2-ol.
| Compound Name | 1,1,1,3,3-pentafluoro-4-[5-methyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 68718144 |
| Molecular Formula | C11H10F5N5O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-4-[5-methyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxybutan-2-ol |
| SMILES | Cc1c(OCC(F)(F)C(O)C(F)(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C11H10F5N5O2/c1-6-7(21-5-17-3-20-21)18-4-19-8(6)23-2-10(12,13)9(22)11(14,15)16/h3-5,9,22H,2H2,1H3 |
| InChIKey | COUHELYDIJQNAR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |