About CID 68718447
CID 68718447 (PubChem CID 68718447) has the molecular formula C12H24B2O4
and a molecular weight of 253.94 g/mol.
Molecular Properties
| Compound Name | CID 68718447 |
| PubChem CID | 68718447 |
| Molecular Formula | C12H24B2O4 |
| Molecular Weight | 253.94 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | — |
| SMILES | CC1(C)O[B]OC1(C)C.CC1(C)O[B]OC1(C)C |
| InChI | InChI=1S/2C6H12BO2/c2*1-5(2)6(3,4)9-7-8-5/h2*1-4H3 |
| InChIKey | HDWCEUQXQGMLDP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.94 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68718447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68718447?
The IUPAC name of CID 68718447 (CID 68718447) is not available.
What is the SMILES notation for CID 68718447?
The canonical SMILES for CID 68718447 is CC1(C)O[B]OC1(C)C.CC1(C)O[B]OC1(C)C.
What is the InChIKey of CID 68718447?
The InChIKey is HDWCEUQXQGMLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12BO2/c2*1-5(2)6(3,4)9-7-8-5/h2*1-4H3.
What are the key properties of CID 68718447?
CID 68718447 has a molecular weight of 253.94 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68718447 is sourced from PubChem (CID 68718447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).