C48H38N6O4 — CID 68718621
4-[2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-3-(4-cyanophenyl)-4,5-bis(4-methoxyphenyl)-2H-imidazol-1-yl]benzonitrile (PubChem CID 68718621) has the molecular formula C48H38N6O4 and a molecular weight of 762.87 g/mol. Its IUPAC name is 4-[2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-3-(4-cyanophenyl)-4,5-bis(4-methoxyphenyl)-2H-imidazol-1-yl]benzonitrile.
| Compound Name | 4-[2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-3-(4-cyanophenyl)-4,5-bis(4-methoxyphenyl)-2H-imidazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 68718621 |
| Molecular Formula | C48H38N6O4 |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 4-[2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-3-(4-cyanophenyl)-4,5-bis(4-methoxyphenyl)-2H-imidazol-1-yl]benzonitrile |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)N(c3ccc(C#N)cc3)C(c3nc(-c4ccc(OC)cc4)c(-c4ccc(OC)cc4)[nH]3)N2c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C48H38N6O4/c1-55-39-21-9-33(10-22-39)43-44(34-11-23-40(56-2)24-12-34)52-47(51-43)48-53(37-17-5-31(29-49)6-18-37)45(35-13-25-41(57-3)26-14-35)46(36-15-27-42(58-4)28-16-36)54(48)38-19-7-32(30-50)8-20-38/h5-28,48H,1-4H3,(H,51,52) |
| InChIKey | RENILNZEQXJDDM-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|