C11H10F5N5O — CID 68718697
5-methyl-4-(2,2,4,4,4-pentafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 68718697) has the molecular formula C11H10F5N5O and a molecular weight of 323.23 g/mol. Its IUPAC name is 5-methyl-4-(2,2,4,4,4-pentafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-methyl-4-(2,2,4,4,4-pentafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 68718697 |
| Molecular Formula | C11H10F5N5O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-methyl-4-(2,2,4,4,4-pentafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1c(OCC(F)(F)CC(F)(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C11H10F5N5O/c1-7-8(21-6-17-4-20-21)18-5-19-9(7)22-3-10(12,13)2-11(14,15)16/h4-6H,2-3H2,1H3 |
| InChIKey | AHNDTZGLJFGHMQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |