C12H14F3N5O — CID 68718763
5-methyl-4-(1,2,4-triazol-1-yl)-6-(5,5,5-trifluoropentoxy)pyrimidine (PubChem CID 68718763) has the molecular formula C12H14F3N5O and a molecular weight of 301.27 g/mol. Its IUPAC name is 5-methyl-4-(1,2,4-triazol-1-yl)-6-(5,5,5-trifluoropentoxy)pyrimidine.
| Compound Name | 5-methyl-4-(1,2,4-triazol-1-yl)-6-(5,5,5-trifluoropentoxy)pyrimidine |
|---|---|
| PubChem CID | 68718763 |
| Molecular Formula | C12H14F3N5O |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-methyl-4-(1,2,4-triazol-1-yl)-6-(5,5,5-trifluoropentoxy)pyrimidine |
| SMILES | Cc1c(OCCCCC(F)(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C12H14F3N5O/c1-9-10(20-8-16-6-19-20)17-7-18-11(9)21-5-3-2-4-12(13,14)15/h6-8H,2-5H2,1H3 |
| InChIKey | ZSNFCTIILABFNV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|