C30H36F3NO3Si — CID 68718850
tert-butyl N-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]carbamate (PubChem CID 68718850) has the molecular formula C30H36F3NO3Si and a molecular weight of 543.70 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 68718850 |
| Molecular Formula | C30H36F3NO3Si |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]carbamate |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C30H36F3NO3Si/c1-20(27(34-28(35)36-29(2,3)4)21-18-24(31)26(33)25(32)19-21)37-38(30(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-20,27H,1-7H3,(H,34,35)/t20-,27+/m1/s1 |
| InChIKey | VGURLWUFGRSMGQ-HRFSGMKKSA-N |
| XLogP | 6.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|