C10H11Cl2N5O — CID 68718859
4-(2,2-dichloropropoxy)-5-methyl-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 68718859) has the molecular formula C10H11Cl2N5O and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-(2,2-dichloropropoxy)-5-methyl-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(2,2-dichloropropoxy)-5-methyl-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 68718859 |
| Molecular Formula | C10H11Cl2N5O |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-(2,2-dichloropropoxy)-5-methyl-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1c(OCC(C)(Cl)Cl)ncnc1-n1cncn1 |
| InChI | InChI=1S/C10H11Cl2N5O/c1-7-8(17-6-13-4-16-17)14-5-15-9(7)18-3-10(2,11)12/h4-6H,3H2,1-2H3 |
| InChIKey | ZQRXFLBUDGDFMO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|