C25H28F3NOSi — CID 68719033
(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propan-1-amine (PubChem CID 68719033) has the molecular formula C25H28F3NOSi and a molecular weight of 443.59 g/mol. Its IUPAC name is (1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propan-1-amine.
| Compound Name | (1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 68719033 |
| Molecular Formula | C25H28F3NOSi |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propan-1-amine |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](N)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C25H28F3NOSi/c1-17(24(29)18-15-21(26)23(28)22(27)16-18)30-31(25(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-17,24H,29H2,1-4H3/t17-,24+/m1/s1 |
| InChIKey | VPSMGHMEYJISMC-OSPHWJPCSA-N |
| XLogP | 5.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|