About 2,6-bis(3,4-diethylphenyl)pyridine
2,6-bis(3,4-diethylphenyl)pyridine (PubChem CID 68719392) has the molecular formula C25H29N
and a molecular weight of 343.51 g/mol. Its IUPAC name is 2,6-bis(3,4-diethylphenyl)pyridine.
Molecular Properties
| Compound Name | 2,6-bis(3,4-diethylphenyl)pyridine |
| PubChem CID | 68719392 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2,6-bis(3,4-diethylphenyl)pyridine |
| SMILES | CCc1ccc(-c2cccc(-c3ccc(CC)c(CC)c3)n2)cc1CC |
| InChI | InChI=1S/C25H29N/c1-5-18-12-14-22(16-20(18)7-3)24-10-9-11-25(26-24)23-15-13-19(6-2)21(8-4)17-23/h9-17H,5-8H2,1-4H3 |
| InChIKey | XCHAMVHJCSSKQJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-bis(3,4-diethylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(3,4-diethylphenyl)pyridine?
The IUPAC name of 2,6-bis(3,4-diethylphenyl)pyridine (CID 68719392) is 2,6-bis(3,4-diethylphenyl)pyridine.
What is the SMILES notation for 2,6-bis(3,4-diethylphenyl)pyridine?
The canonical SMILES for 2,6-bis(3,4-diethylphenyl)pyridine is CCc1ccc(-c2cccc(-c3ccc(CC)c(CC)c3)n2)cc1CC.
What is the InChIKey of 2,6-bis(3,4-diethylphenyl)pyridine?
The InChIKey is XCHAMVHJCSSKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N/c1-5-18-12-14-22(16-20(18)7-3)24-10-9-11-25(26-24)23-15-13-19(6-2)21(8-4)17-23/h9-17H,5-8H2,1-4H3.
What are the key properties of 2,6-bis(3,4-diethylphenyl)pyridine?
2,6-bis(3,4-diethylphenyl)pyridine has a molecular weight of 343.51 g/mol, XLogP of 6.67, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(3,4-diethylphenyl)pyridine is sourced from PubChem (CID 68719392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).