C25H30O5 — CID 68719488
(4R,10'S,13'S)-2-acetyl-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione (PubChem CID 68719488) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (4R,10'S,13'S)-2-acetyl-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione.
| Compound Name | (4R,10'S,13'S)-2-acetyl-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
|---|---|
| PubChem CID | 68719488 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4R,10'S,13'S)-2-acetyl-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
| SMILES | CC(=O)C1(C)OCC(=O)[C@]2(CCC3C4CCC5=CC(=O)C=C[C@]5(C)C4=CC[C@@]32C)O1 |
| InChI | InChI=1S/C25H30O5/c1-15(26)24(4)29-14-21(28)25(30-24)12-9-20-18-6-5-16-13-17(27)7-10-22(16,2)19(18)8-11-23(20,25)3/h7-8,10,13,18,20H,5-6,9,11-12,14H2,1-4H3/t18?,20?,22-,23-,24?,25-/m0/s1 |
| InChIKey | WUMBVNGTPIWZOU-APHQHEDZSA-N |
| XLogP | 3.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|