C13H22N4O6 — CID 68719493
4-amino-2-[4-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]butyl]-1H-imidazole-5-carboxamide (PubChem CID 68719493) has the molecular formula C13H22N4O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-amino-2-[4-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]butyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-amino-2-[4-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]butyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 68719493 |
| Molecular Formula | C13H22N4O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-amino-2-[4-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]butyl]-1H-imidazole-5-carboxamide |
| SMILES | NC(=O)c1[nH]c(CCCC[C@@]2(O)O[C@H](CO)[C@@H](O)[C@H]2O)nc1N |
| InChI | InChI=1S/C13H22N4O6/c14-11-8(12(15)21)16-7(17-11)3-1-2-4-13(22)10(20)9(19)6(5-18)23-13/h6,9-10,18-20,22H,1-5,14H2,(H2,15,21)(H,16,17)/t6-,9-,10-,13-/m1/s1 |
| InChIKey | MPZAYARDTGJJPT-ZRFIDHNTSA-N |
| XLogP | -2.39 |
| TPSA | 187.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|