About (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate
(2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate (PubChem CID 68719570) has the molecular formula C7H11NO5
and a molecular weight of 189.17 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate |
| PubChem CID | 68719570 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C7H11NO5/c1-2-8-6(9)11-3-5-4-12-7(10)13-5/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | WGUCKKUEOJLXAL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate (CID 68719570) is (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate is CCNC(=O)OCC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate?
The InChIKey is WGUCKKUEOJLXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO5/c1-2-8-6(9)11-3-5-4-12-7(10)13-5/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate?
(2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate has a molecular weight of 189.17 g/mol, XLogP of 0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl)methyl N-ethylcarbamate is sourced from PubChem (CID 68719570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).