C36H48O6Si — CID 68720205
[(E,2S,3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] acetate (PubChem CID 68720205) has the molecular formula C36H48O6Si and a molecular weight of 604.86 g/mol. Its IUPAC name is [(E,2S,3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] acetate.
| Compound Name | [(E,2S,3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 68720205 |
| Molecular Formula | C36H48O6Si |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | [(E,2S,3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](/C=C/CO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C36H48O6Si/c1-29(37)42-34(28-38-25-30-17-10-7-11-18-30)35(40-27-32-21-14-9-15-22-32)33(39-26-31-19-12-8-13-20-31)23-16-24-41-43(5,6)36(2,3)4/h7-23,33-35H,24-28H2,1-6H3/b23-16+/t33-,34+,35-/m1/s1 |
| InChIKey | RMBIRCBILDSPRV-ATDQYEGFSA-N |
| XLogP | 7.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|