About ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate
ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate (PubChem CID 68720526) has the molecular formula C17H32N2O6
and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate |
| PubChem CID | 68720526 |
| Molecular Formula | C17H32N2O6 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(O)CC1.CCOC(=O)N1CCC(OC)CC1 |
| InChI | InChI=1S/C9H17NO3.C8H15NO3/c1-3-13-9(11)10-6-4-8(12-2)5-7-10;1-2-12-8(11)9-5-3-7(10)4-6-9/h8H,3-7H2,1-2H3;7,10H,2-6H2,1H3 |
| InChIKey | DEIVJEUXZKGKMC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate?
The IUPAC name of ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate (CID 68720526) is ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate?
The canonical SMILES for ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate is CCOC(=O)N1CCC(O)CC1.CCOC(=O)N1CCC(OC)CC1.
What is the InChIKey of ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate?
The InChIKey is DEIVJEUXZKGKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3.C8H15NO3/c1-3-13-9(11)10-6-4-8(12-2)5-7-10;1-2-12-8(11)9-5-3-7(10)4-6-9/h8H,3-7H2,1-2H3;7,10H,2-6H2,1H3.
What are the key properties of ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate?
ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate has a molecular weight of 360.45 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxypiperidine-1-carboxylate;ethyl 4-methoxypiperidine-1-carboxylate is sourced from PubChem (CID 68720526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).