C24H27NO3 — CID 68720571
2-[(2-hex-2-enyl-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 68720571) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-[(2-hex-2-enyl-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[(2-hex-2-enyl-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 68720571 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[(2-hex-2-enyl-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | CCCC=CCc1c(C)cccc1C(=O)NC1(C(=O)O)Cc2ccccc2C1 |
| InChI | InChI=1S/C24H27NO3/c1-3-4-5-6-13-20-17(2)10-9-14-21(20)22(26)25-24(23(27)28)15-18-11-7-8-12-19(18)16-24/h5-12,14H,3-4,13,15-16H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | DFDGQVMELWQAHH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|