About 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide
6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide (PubChem CID 68720807) has the molecular formula C9H9FN2O2
and a molecular weight of 196.18 g/mol. Its IUPAC name is 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide.
Molecular Properties
| Compound Name | 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide |
| PubChem CID | 68720807 |
| Molecular Formula | C9H9FN2O2 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide |
| SMILES | NC(=O)C1CNOc2ccc(F)cc21 |
| InChI | InChI=1S/C9H9FN2O2/c10-5-1-2-8-6(3-5)7(9(11)13)4-12-14-8/h1-3,7,12H,4H2,(H2,11,13) |
| InChIKey | SSFXBDOAQSWYGN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide?
The IUPAC name of 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide (CID 68720807) is 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide.
What is the SMILES notation for 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide?
The canonical SMILES for 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide is NC(=O)C1CNOc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide?
The InChIKey is SSFXBDOAQSWYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O2/c10-5-1-2-8-6(3-5)7(9(11)13)4-12-14-8/h1-3,7,12H,4H2,(H2,11,13).
What are the key properties of 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide?
6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide has a molecular weight of 196.18 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4-dihydro-2H-1,2-benzoxazine-4-carboxamide is sourced from PubChem (CID 68720807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).