About 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline
1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline (PubChem CID 68721105) has the molecular formula C16H15Br2N3O
and a molecular weight of 425.12 g/mol. Its IUPAC name is 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline.
Molecular Properties
| Compound Name | 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline |
| PubChem CID | 68721105 |
| Molecular Formula | C16H15Br2N3O |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline |
| SMILES | CC(=O)n1ncc2cc(Br)ccc21.Cc1cc(Br)ccc1N |
| InChI | InChI=1S/C9H7BrN2O.C7H8BrN/c1-6(13)12-9-3-2-8(10)4-7(9)5-11-12;1-5-4-6(8)2-3-7(5)9/h2-5H,1H3;2-4H,9H2,1H3 |
| InChIKey | BAIKIBUDSCCJQI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline?
The IUPAC name of 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline (CID 68721105) is 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline.
What is the SMILES notation for 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline?
The canonical SMILES for 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline is CC(=O)n1ncc2cc(Br)ccc21.Cc1cc(Br)ccc1N.
What is the InChIKey of 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline?
The InChIKey is BAIKIBUDSCCJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O.C7H8BrN/c1-6(13)12-9-3-2-8(10)4-7(9)5-11-12;1-5-4-6(8)2-3-7(5)9/h2-5H,1H3;2-4H,9H2,1H3.
What are the key properties of 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline?
1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline has a molecular weight of 425.12 g/mol, XLogP of 4.80, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromoindazol-1-yl)ethanone;4-bromo-2-methylaniline is sourced from PubChem (CID 68721105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).