C13H21N3O2 — CID 68721410
(2S)-2-amino-N'-(4-methoxyphenyl)-3-methylpentanehydrazide (PubChem CID 68721410) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2S)-2-amino-N'-(4-methoxyphenyl)-3-methylpentanehydrazide.
| Compound Name | (2S)-2-amino-N'-(4-methoxyphenyl)-3-methylpentanehydrazide |
|---|---|
| PubChem CID | 68721410 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (2S)-2-amino-N'-(4-methoxyphenyl)-3-methylpentanehydrazide |
| SMILES | CCC(C)[C@H](N)C(=O)NNc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H21N3O2/c1-4-9(2)12(14)13(17)16-15-10-5-7-11(18-3)8-6-10/h5-9,12,15H,4,14H2,1-3H3,(H,16,17)/t9?,12-/m0/s1 |
| InChIKey | MSABZNLMUOSIAC-ACGXKRRESA-N |
| XLogP | 1.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|