C31H33N5O3 — CID 68721749
N-[1-benzyl-5-[4-(2-cyanophenyl)piperazine-1-carbonyl]pyrrolidin-3-yl]-2-methoxybenzamide (PubChem CID 68721749) has the molecular formula C31H33N5O3 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[1-benzyl-5-[4-(2-cyanophenyl)piperazine-1-carbonyl]pyrrolidin-3-yl]-2-methoxybenzamide.
| Compound Name | N-[1-benzyl-5-[4-(2-cyanophenyl)piperazine-1-carbonyl]pyrrolidin-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 68721749 |
| Molecular Formula | C31H33N5O3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | N-[1-benzyl-5-[4-(2-cyanophenyl)piperazine-1-carbonyl]pyrrolidin-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC1CC(C(=O)N2CCN(c3ccccc3C#N)CC2)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H33N5O3/c1-39-29-14-8-6-12-26(29)30(37)33-25-19-28(36(22-25)21-23-9-3-2-4-10-23)31(38)35-17-15-34(16-18-35)27-13-7-5-11-24(27)20-32/h2-14,25,28H,15-19,21-22H2,1H3,(H,33,37) |
| InChIKey | GOBNIVBLDRZMPC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |