About (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid (PubChem CID 68722102) has the molecular formula C9H16BNO4
and a molecular weight of 213.04 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid.
Molecular Properties
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid |
| PubChem CID | 68722102 |
| Molecular Formula | C9H16BNO4 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cocn1 |
| InChI | InChI=1S/C9H16BNO4/c1-8(2,12)9(3,4)15-10(13)7-5-14-6-11-7/h5-6,12-13H,1-4H3 |
| InChIKey | KJNQUDAIGZJCEV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid?
The IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid (CID 68722102) is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid.
What is the SMILES notation for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid?
The canonical SMILES for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid is CC(C)(O)C(C)(C)OB(O)c1cocn1.
What is the InChIKey of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid?
The InChIKey is KJNQUDAIGZJCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BNO4/c1-8(2,12)9(3,4)15-10(13)7-5-14-6-11-7/h5-6,12-13H,1-4H3.
What are the key properties of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid?
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid has a molecular weight of 213.04 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,3-oxazol-4-yl)borinic acid is sourced from PubChem (CID 68722102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).