About 1-fluorobutyl piperazine-1-carboxylate
1-fluorobutyl piperazine-1-carboxylate (PubChem CID 68722112) has the molecular formula C9H17FN2O2
and a molecular weight of 204.24 g/mol. Its IUPAC name is 1-fluorobutyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 1-fluorobutyl piperazine-1-carboxylate |
| PubChem CID | 68722112 |
| Molecular Formula | C9H17FN2O2 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-fluorobutyl piperazine-1-carboxylate |
| SMILES | CCCC(F)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H17FN2O2/c1-2-3-8(10)14-9(13)12-6-4-11-5-7-12/h8,11H,2-7H2,1H3 |
| InChIKey | AORQNJIKKLWZRY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-fluorobutyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobutyl piperazine-1-carboxylate?
The IUPAC name of 1-fluorobutyl piperazine-1-carboxylate (CID 68722112) is 1-fluorobutyl piperazine-1-carboxylate.
What is the SMILES notation for 1-fluorobutyl piperazine-1-carboxylate?
The canonical SMILES for 1-fluorobutyl piperazine-1-carboxylate is CCCC(F)OC(=O)N1CCNCC1.
What is the InChIKey of 1-fluorobutyl piperazine-1-carboxylate?
The InChIKey is AORQNJIKKLWZRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FN2O2/c1-2-3-8(10)14-9(13)12-6-4-11-5-7-12/h8,11H,2-7H2,1H3.
What are the key properties of 1-fluorobutyl piperazine-1-carboxylate?
1-fluorobutyl piperazine-1-carboxylate has a molecular weight of 204.24 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutyl piperazine-1-carboxylate is sourced from PubChem (CID 68722112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).