About 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol
2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 68722196) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 68722196 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)(C)C1=CC=CC(CO)(C(C)(C)C)C1O |
| InChI | InChI=1S/C15H26O2/c1-13(2,3)11-8-7-9-15(10-16,12(11)17)14(4,5)6/h7-9,12,16-17H,10H2,1-6H3 |
| InChIKey | TXOZUMFXMPRRIC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol (CID 68722196) is 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol is CC(C)(C)C1=CC=CC(CO)(C(C)(C)C)C1O.
What is the InChIKey of 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is TXOZUMFXMPRRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-13(2,3)11-8-7-9-15(10-16,12(11)17)14(4,5)6/h7-9,12,16-17H,10H2,1-6H3.
What are the key properties of 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 238.37 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 68722196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).