methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate

C27H20N2O4 — CID 68722321

IUPACmethyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate
SMILESCOC(=O)c1cc(-c2ccc3c(=O)[nH]ccc3c2)c(C)c(-c2ccc3c(=O)[nH]ccc3c2)c1
InChIInChI=1S/C27H20N2O4/c1-15-23(16-3-5-21-18(11-16)7-9-28-25(21)30)13-20(27(32)33-2)14-24(15)17-4-6-22-19(12-17)8-10-29-26(22)31/h3-14H,1-2H3,(H,28,30)(H,29,31)
InChIKeyJCSLAOKHTRHQQT-UHFFFAOYSA-N
MW436.47 g/mol
LogP4.80
Rot. Bonds3

About methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate

methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate (PubChem CID 68722321) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate
PubChem CID68722321
Molecular FormulaC27H20N2O4
Molecular Weight436.47 g/mol
Exact Mass436.14
IUPAC Namemethyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate
SMILESCOC(=O)c1cc(-c2ccc3c(=O)[nH]ccc3c2)c(C)c(-c2ccc3c(=O)[nH]ccc3c2)c1
InChIInChI=1S/C27H20N2O4/c1-15-23(16-3-5-21-18(11-16)7-9-28-25(21)30)13-20(27(32)33-2)14-24(15)17-4-6-22-19(12-17)8-10-29-26(22)31/h3-14H,1-2H3,(H,28,30)(H,29,31)
InChIKeyJCSLAOKHTRHQQT-UHFFFAOYSA-N
XLogP4.80
TPSA92.02 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms33
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500436.47
LogP ≤ 54.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate?
The IUPAC name of methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate (CID 68722321) is methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate.
What is the SMILES notation for methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate?
The canonical SMILES for methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate is COC(=O)c1cc(-c2ccc3c(=O)[nH]ccc3c2)c(C)c(-c2ccc3c(=O)[nH]ccc3c2)c1.
What is the InChIKey of methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate?
The InChIKey is JCSLAOKHTRHQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N2O4/c1-15-23(16-3-5-21-18(11-16)7-9-28-25(21)30)13-20(27(32)33-2)14-24(15)17-4-6-22-19(12-17)8-10-29-26(22)31/h3-14H,1-2H3,(H,28,30)(H,29,31).
What are the key properties of methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate?
methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate has a molecular weight of 436.47 g/mol, XLogP of 4.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3,5-bis(1-oxo-2H-isoquinolin-6-yl)benzoate is sourced from PubChem (CID 68722321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).