C23H25Cl2NO3S2 — CID 68722659
2-[2-[(1R,2R,3R,5R)-2-[2-(3-but-3-enyl-5-chlorophenyl)ethenyl]-5-chloro-3-hydroxycyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 68722659) has the molecular formula C23H25Cl2NO3S2 and a molecular weight of 498.50 g/mol. Its IUPAC name is 2-[2-[(1R,2R,3R,5R)-2-[2-(3-but-3-enyl-5-chlorophenyl)ethenyl]-5-chloro-3-hydroxycyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(1R,2R,3R,5R)-2-[2-(3-but-3-enyl-5-chlorophenyl)ethenyl]-5-chloro-3-hydroxycyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68722659 |
| Molecular Formula | C23H25Cl2NO3S2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[2-[(1R,2R,3R,5R)-2-[2-(3-but-3-enyl-5-chlorophenyl)ethenyl]-5-chloro-3-hydroxycyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=CCCc1cc(Cl)cc(C=C[C@@H]2[C@@H](CCSc3nc(C(=O)O)cs3)[C@H](Cl)C[C@H]2O)c1 |
| InChI | InChI=1S/C23H25Cl2NO3S2/c1-2-3-4-14-9-15(11-16(24)10-14)5-6-18-17(19(25)12-21(18)27)7-8-30-23-26-20(13-31-23)22(28)29/h2,5-6,9-11,13,17-19,21,27H,1,3-4,7-8,12H2,(H,28,29)/t17-,18-,19-,21-/m1/s1 |
| InChIKey | PJGFZUBLJSMVLV-ANTGDGSKSA-N |
| XLogP | 6.41 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|