About CID 68723764
CID 68723764 (PubChem CID 68723764) has the molecular formula C12H6O2SSi2
and a molecular weight of 270.42 g/mol.
Molecular Properties
| Compound Name | CID 68723764 |
| PubChem CID | 68723764 |
| Molecular Formula | C12H6O2SSi2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | — |
| SMILES | O=S1(=O)c2ccccc2-c2c1ccc([Si])c2[Si] |
| InChI | InChI=1S/C12H6O2SSi2/c13-15(14)8-4-2-1-3-7(8)11-9(15)5-6-10(16)12(11)17/h1-6H |
| InChIKey | HWNLALGNMFPLHE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68723764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68723764?
The IUPAC name of CID 68723764 (CID 68723764) is not available.
What is the SMILES notation for CID 68723764?
The canonical SMILES for CID 68723764 is O=S1(=O)c2ccccc2-c2c1ccc([Si])c2[Si].
What is the InChIKey of CID 68723764?
The InChIKey is HWNLALGNMFPLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6O2SSi2/c13-15(14)8-4-2-1-3-7(8)11-9(15)5-6-10(16)12(11)17/h1-6H.
What are the key properties of CID 68723764?
CID 68723764 has a molecular weight of 270.42 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68723764 is sourced from PubChem (CID 68723764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).