About ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate
ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate (PubChem CID 68723801) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate.
Molecular Properties
| Compound Name | ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate |
| PubChem CID | 68723801 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate |
| SMILES | CCOC(=O)C1C(C)=CC=CC12CCCC2 |
| InChI | InChI=1S/C14H20O2/c1-3-16-13(15)12-11(2)7-6-10-14(12)8-4-5-9-14/h6-7,10,12H,3-5,8-9H2,1-2H3 |
| InChIKey | KOIUONQPHPSWPR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate?
The IUPAC name of ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate (CID 68723801) is ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate.
What is the SMILES notation for ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate?
The canonical SMILES for ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate is CCOC(=O)C1C(C)=CC=CC12CCCC2.
What is the InChIKey of ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate?
The InChIKey is KOIUONQPHPSWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-16-13(15)12-11(2)7-6-10-14(12)8-4-5-9-14/h6-7,10,12H,3-5,8-9H2,1-2H3.
What are the key properties of ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate?
ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate has a molecular weight of 220.31 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-methylspiro[4.5]deca-6,8-diene-10-carboxylate is sourced from PubChem (CID 68723801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).