C22H17Cl2N3O3 — CID 6872462
N-(3,4-dichlorophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 6872462) has the molecular formula C22H17Cl2N3O3 and a molecular weight of 442.30 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3,4-dichlorophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6872462 |
| Molecular Formula | C22H17Cl2N3O3 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccccc1OCc1ccccc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N3O3/c23-18-11-10-17(12-19(18)24)26-21(28)22(29)27-25-13-16-8-4-5-9-20(16)30-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,26,28)(H,27,29)/b25-13+ |
| InChIKey | NFXPFOOGEVGHDO-DHRITJCHSA-N |
| XLogP | 4.66 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|