C37H40Cl2N2O5 — CID 68724721
[2-[4-[2-(3-acetamidopropyl)phenyl]-2-methylphenyl]-3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]propyl]carbamic acid (PubChem CID 68724721) has the molecular formula C37H40Cl2N2O5 and a molecular weight of 663.64 g/mol. Its IUPAC name is [2-[4-[2-(3-acetamidopropyl)phenyl]-2-methylphenyl]-3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]propyl]carbamic acid.
| Compound Name | [2-[4-[2-(3-acetamidopropyl)phenyl]-2-methylphenyl]-3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]propyl]carbamic acid |
|---|---|
| PubChem CID | 68724721 |
| Molecular Formula | C37H40Cl2N2O5 |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | [2-[4-[2-(3-acetamidopropyl)phenyl]-2-methylphenyl]-3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]propyl]carbamic acid |
| SMILES | CC(=O)NCCCc1ccccc1-c1ccc(C(CNC(=O)O)Cc2ccc(OCCOc3c(Cl)cc(C)cc3Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C37H40Cl2N2O5/c1-24-19-34(38)36(35(39)20-24)46-18-17-45-31-13-10-27(11-14-31)22-30(23-41-37(43)44)32-15-12-29(21-25(32)2)33-9-5-4-7-28(33)8-6-16-40-26(3)42/h4-5,7,9-15,19-21,30,41H,6,8,16-18,22-23H2,1-3H3,(H,40,42)(H,43,44) |
| InChIKey | ZNJOGORQAMWBRM-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|