C22H21NO3S — CID 68724784
5-[3-[(1S,2S,3R,5S)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 68724784) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 5-[3-[(1S,2S,3R,5S)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1S,2S,3R,5S)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68724784 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 5-[3-[(1S,2S,3R,5S)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | N#C[C@H]1C[C@@H](O)[C@H](C#Cc2ccccc2)[C@H]1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C22H21NO3S/c23-14-16-13-20(24)19(11-9-15-5-2-1-3-6-15)18(16)8-4-7-17-10-12-21(27-17)22(25)26/h1-3,5-6,10,12,16,18-20,24H,4,7-8,13H2,(H,25,26)/t16-,18+,19-,20-/m1/s1 |
| InChIKey | UDJNEXIKFLPQPN-GSEOLPGOSA-N |
| XLogP | 3.96 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|