C20H19F3N2O4 — CID 68725061
1-N'-[[4-[4-methoxy-2-(trifluoromethyl)phenoxy]phenyl]methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 68725061) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 1-N'-[[4-[4-methoxy-2-(trifluoromethyl)phenoxy]phenyl]methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[[4-[4-methoxy-2-(trifluoromethyl)phenoxy]phenyl]methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68725061 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-N'-[[4-[4-methoxy-2-(trifluoromethyl)phenoxy]phenyl]methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(Oc2ccc(CNC(=O)C3(C(N)=O)CC3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-28-14-6-7-16(15(10-14)20(21,22)23)29-13-4-2-12(3-5-13)11-25-18(27)19(8-9-19)17(24)26/h2-7,10H,8-9,11H2,1H3,(H2,24,26)(H,25,27) |
| InChIKey | URPYJBMFAYDGPM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|