C10H18N2O2 — CID 68725384
(3S,3aS,6aR)-3-(aminomethyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 68725384) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-(aminomethyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3S,3aS,6aR)-3-(aminomethyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 68725384 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3S,3aS,6aR)-3-(aminomethyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | CC1C[C@H]2CN(C(=O)O)[C@H](CN)[C@H]2C1 |
| InChI | InChI=1S/C10H18N2O2/c1-6-2-7-5-12(10(13)14)9(4-11)8(7)3-6/h6-9H,2-5,11H2,1H3,(H,13,14)/t6?,7-,8-,9+/m0/s1 |
| InChIKey | GGVKBXYAHZPKMZ-IZVRKBBXSA-N |
| XLogP | 0.97 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |