C31H36F2N4O2 — CID 68725622
[(2S,4S)-2-benzyl-4-[(2,4-difluorophenyl)methylamino]pyrrolidin-2-yl]-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 68725622) has the molecular formula C31H36F2N4O2 and a molecular weight of 534.65 g/mol. Its IUPAC name is [(2S,4S)-2-benzyl-4-[(2,4-difluorophenyl)methylamino]pyrrolidin-2-yl]-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(2S,4S)-2-benzyl-4-[(2,4-difluorophenyl)methylamino]pyrrolidin-2-yl]-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 68725622 |
| Molecular Formula | C31H36F2N4O2 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(2S,4S)-2-benzyl-4-[(2,4-difluorophenyl)methylamino]pyrrolidin-2-yl]-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(N2CCN(C(=O)[C@]3(Cc4ccccc4)C[C@H](NCc4ccc(F)cc4F)CN3)CC2)cc1 |
| InChI | InChI=1S/C31H36F2N4O2/c1-2-39-28-12-10-27(11-13-28)36-14-16-37(17-15-36)30(38)31(19-23-6-4-3-5-7-23)20-26(22-35-31)34-21-24-8-9-25(32)18-29(24)33/h3-13,18,26,34-35H,2,14-17,19-22H2,1H3/t26-,31-/m0/s1 |
| InChIKey | XCBQDTXHXVSWST-HVNZXBJASA-N |
| XLogP | 4.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|