C12H20O — CID 68725670
4-(2-methylpropoxy)-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 68725670) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 4-(2-methylpropoxy)-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 68725670 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4-(2-methylpropoxy)-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | CC(C)COC1C=CC2CCCC21 |
| InChI | InChI=1S/C12H20O/c1-9(2)8-13-12-7-6-10-4-3-5-11(10)12/h6-7,9-12H,3-5,8H2,1-2H3 |
| InChIKey | CDXHSSAUXVRRPN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|